C17H24O3 — CID 175410539
5-dec-1-enyl-2,3-dihydroxybenzaldehyde (PubChem CID 175410539) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is 5-dec-1-enyl-2,3-dihydroxybenzaldehyde.
| Compound Name | 5-dec-1-enyl-2,3-dihydroxybenzaldehyde |
|---|---|
| PubChem CID | 175410539 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 5-dec-1-enyl-2,3-dihydroxybenzaldehyde |
| SMILES | CCCCCCCCC=Cc1cc(O)c(O)c(C=O)c1 |
| InChI | InChI=1S/C17H24O3/c1-2-3-4-5-6-7-8-9-10-14-11-15(13-18)17(20)16(19)12-14/h9-13,19-20H,2-8H2,1H3 |
| InChIKey | ZXTHKTITVRMQKI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|