C18H28O2 — CID 102295508
1-[(E)-dec-1-enyl]-3,5-dimethoxybenzene (PubChem CID 102295508) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is 1-[(E)-dec-1-enyl]-3,5-dimethoxybenzene.
| Compound Name | 1-[(E)-dec-1-enyl]-3,5-dimethoxybenzene |
|---|---|
| PubChem CID | 102295508 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 1-[(E)-dec-1-enyl]-3,5-dimethoxybenzene |
| SMILES | CCCCCCCC/C=C/c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C18H28O2/c1-4-5-6-7-8-9-10-11-12-16-13-17(19-2)15-18(14-16)20-3/h11-15H,4-10H2,1-3H3/b12-11+ |
| InChIKey | QDEANABHZABSRX-VAWYXSNFSA-N |
| XLogP | 5.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|