C14H20O2 — CID 54079025
5-oct-1-enylbenzene-1,3-diol (PubChem CID 54079025) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is 5-oct-1-enylbenzene-1,3-diol.
| Compound Name | 5-oct-1-enylbenzene-1,3-diol |
|---|---|
| PubChem CID | 54079025 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 5-oct-1-enylbenzene-1,3-diol |
| SMILES | CCCCCCC=Cc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C14H20O2/c1-2-3-4-5-6-7-8-12-9-13(15)11-14(16)10-12/h7-11,15-16H,2-6H2,1H3 |
| InChIKey | MLTDAQBMPDSTEO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|