C21H32O2 — CID 75111208
5-pentadeca-2,8-dienylbenzene-1,3-diol (PubChem CID 75111208) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is 5-pentadeca-2,8-dienylbenzene-1,3-diol.
| Compound Name | 5-pentadeca-2,8-dienylbenzene-1,3-diol |
|---|---|
| PubChem CID | 75111208 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | 5-pentadeca-2,8-dienylbenzene-1,3-diol |
| SMILES | CCCCCCC=CCCCCC=CCc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C21H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-16-20(22)18-21(23)17-19/h7-8,13-14,16-18,22-23H,2-6,9-12,15H2,1H3 |
| InChIKey | RBMKZBCHFBGXFK-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|