C19H30O2 — CID 53436336
5-tridec-8-enylbenzene-1,3-diol (PubChem CID 53436336) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is 5-tridec-8-enylbenzene-1,3-diol.
| Compound Name | 5-tridec-8-enylbenzene-1,3-diol |
|---|---|
| PubChem CID | 53436336 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 5-tridec-8-enylbenzene-1,3-diol |
| SMILES | CCCCC=CCCCCCCCc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C19H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-17-14-18(20)16-19(21)15-17/h5-6,14-16,20-21H,2-4,7-13H2,1H3 |
| InChIKey | ILUMNMFPGSFYMK-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|