About 5-[6-(3,5-dihydroxyphenyl)hexyl]benzene-1,3-diol
5-[6-(3,5-dihydroxyphenyl)hexyl]benzene-1,3-diol (PubChem CID 71394044) has the molecular formula C18H22O4
and a molecular weight of 302.37 g/mol. Its IUPAC name is 5-[6-(3,5-dihydroxyphenyl)hexyl]benzene-1,3-diol.
Molecular Properties
| Compound Name | 5-[6-(3,5-dihydroxyphenyl)hexyl]benzene-1,3-diol |
| PubChem CID | 71394044 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 5-[6-(3,5-dihydroxyphenyl)hexyl]benzene-1,3-diol |
| SMILES | Oc1cc(O)cc(CCCCCCc2cc(O)cc(O)c2)c1 |
| InChI | InChI=1S/C18H22O4/c19-15-7-13(8-16(20)11-15)5-3-1-2-4-6-14-9-17(21)12-18(22)10-14/h7-12,19-22H,1-6H2 |
| InChIKey | ZBJKCUGYASZYAS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[6-(3,5-dihydroxyphenyl)hexyl]benzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[6-(3,5-dihydroxyphenyl)hexyl]benzene-1,3-diol?
The IUPAC name of 5-[6-(3,5-dihydroxyphenyl)hexyl]benzene-1,3-diol (CID 71394044) is 5-[6-(3,5-dihydroxyphenyl)hexyl]benzene-1,3-diol.
What is the SMILES notation for 5-[6-(3,5-dihydroxyphenyl)hexyl]benzene-1,3-diol?
The canonical SMILES for 5-[6-(3,5-dihydroxyphenyl)hexyl]benzene-1,3-diol is Oc1cc(O)cc(CCCCCCc2cc(O)cc(O)c2)c1.
What is the InChIKey of 5-[6-(3,5-dihydroxyphenyl)hexyl]benzene-1,3-diol?
The InChIKey is ZBJKCUGYASZYAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22O4/c19-15-7-13(8-16(20)11-15)5-3-1-2-4-6-14-9-17(21)12-18(22)10-14/h7-12,19-22H,1-6H2.
What are the key properties of 5-[6-(3,5-dihydroxyphenyl)hexyl]benzene-1,3-diol?
5-[6-(3,5-dihydroxyphenyl)hexyl]benzene-1,3-diol has a molecular weight of 302.37 g/mol, XLogP of 3.85, 7 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[6-(3,5-dihydroxyphenyl)hexyl]benzene-1,3-diol is sourced from PubChem (CID 71394044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).