About 3,5-dibutylphenol
3,5-dibutylphenol (PubChem CID 15936149) has the molecular formula C14H22O
and a molecular weight of 206.33 g/mol. Its IUPAC name is 3,5-dibutylphenol.
Molecular Properties
| Compound Name | 3,5-dibutylphenol |
| PubChem CID | 15936149 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 3,5-dibutylphenol |
| SMILES | CCCCc1cc(O)cc(CCCC)c1 |
| InChI | InChI=1S/C14H22O/c1-3-5-7-12-9-13(8-6-4-2)11-14(15)10-12/h9-11,15H,3-8H2,1-2H3 |
| InChIKey | HRUHVKFKXJGKBQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,5-dibutylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dibutylphenol?
The IUPAC name of 3,5-dibutylphenol (CID 15936149) is 3,5-dibutylphenol.
What is the SMILES notation for 3,5-dibutylphenol?
The canonical SMILES for 3,5-dibutylphenol is CCCCc1cc(O)cc(CCCC)c1.
What is the InChIKey of 3,5-dibutylphenol?
The InChIKey is HRUHVKFKXJGKBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O/c1-3-5-7-12-9-13(8-6-4-2)11-14(15)10-12/h9-11,15H,3-8H2,1-2H3.
What are the key properties of 3,5-dibutylphenol?
3,5-dibutylphenol has a molecular weight of 206.33 g/mol, XLogP of 4.08, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dibutylphenol is sourced from PubChem (CID 15936149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).