C24H36O2 — CID 159891553
4-butylphenol;3,5-dibutylphenol (PubChem CID 159891553) has the molecular formula C24H36O2 and a molecular weight of 356.55 g/mol. Its IUPAC name is 4-butylphenol;3,5-dibutylphenol.
| Compound Name | 4-butylphenol;3,5-dibutylphenol |
|---|---|
| PubChem CID | 159891553 |
| Molecular Formula | C24H36O2 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | 4-butylphenol;3,5-dibutylphenol |
| SMILES | CCCCc1cc(O)cc(CCCC)c1.CCCCc1ccc(O)cc1 |
| InChI | InChI=1S/C14H22O.C10H14O/c1-3-5-7-12-9-13(8-6-4-2)11-14(15)10-12;1-2-3-4-9-5-7-10(11)8-6-9/h9-11,15H,3-8H2,1-2H3;5-8,11H,2-4H2,1H3 |
| InChIKey | NUUWAAUVULJCMZ-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |