About lithium;4-butylphenol;hydride
lithium;4-butylphenol;hydride (PubChem CID 174758234) has the molecular formula C10H15LiO
and a molecular weight of 158.17 g/mol. Its IUPAC name is lithium;4-butylphenol;hydride.
Molecular Properties
| Compound Name | lithium;4-butylphenol;hydride |
| PubChem CID | 174758234 |
| Molecular Formula | C10H15LiO |
| Molecular Weight | 158.17 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | lithium;4-butylphenol;hydride |
| SMILES | CCCCc1ccc(O)cc1.[H-].[Li+] |
| InChI | InChI=1S/C10H14O.Li.H/c1-2-3-4-9-5-7-10(11)8-6-9;;/h5-8,11H,2-4H2,1H3;;/q;+1;-1 |
| InChIKey | FBWTYPJLHLUKOZ-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.17 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze lithium;4-butylphenol;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;4-butylphenol;hydride?
The IUPAC name of lithium;4-butylphenol;hydride (CID 174758234) is lithium;4-butylphenol;hydride.
What is the SMILES notation for lithium;4-butylphenol;hydride?
The canonical SMILES for lithium;4-butylphenol;hydride is CCCCc1ccc(O)cc1.[H-].[Li+].
What is the InChIKey of lithium;4-butylphenol;hydride?
The InChIKey is FBWTYPJLHLUKOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O.Li.H/c1-2-3-4-9-5-7-10(11)8-6-9;;/h5-8,11H,2-4H2,1H3;;/q;+1;-1.
What are the key properties of lithium;4-butylphenol;hydride?
lithium;4-butylphenol;hydride has a molecular weight of 158.17 g/mol, XLogP of -0.15, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;4-butylphenol;hydride is sourced from PubChem (CID 174758234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).