About 4-butylphenol;propanoic acid
4-butylphenol;propanoic acid (PubChem CID 70308169) has the molecular formula C13H20O3
and a molecular weight of 224.30 g/mol. Its IUPAC name is 4-butylphenol;propanoic acid.
Molecular Properties
| Compound Name | 4-butylphenol;propanoic acid |
| PubChem CID | 70308169 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 4-butylphenol;propanoic acid |
| SMILES | CCC(=O)O.CCCCc1ccc(O)cc1 |
| InChI | InChI=1S/C10H14O.C3H6O2/c1-2-3-4-9-5-7-10(11)8-6-9;1-2-3(4)5/h5-8,11H,2-4H2,1H3;2H2,1H3,(H,4,5) |
| InChIKey | RAUVKJQBNAXAMI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-butylphenol;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butylphenol;propanoic acid?
The IUPAC name of 4-butylphenol;propanoic acid (CID 70308169) is 4-butylphenol;propanoic acid.
What is the SMILES notation for 4-butylphenol;propanoic acid?
The canonical SMILES for 4-butylphenol;propanoic acid is CCC(=O)O.CCCCc1ccc(O)cc1.
What is the InChIKey of 4-butylphenol;propanoic acid?
The InChIKey is RAUVKJQBNAXAMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O.C3H6O2/c1-2-3-4-9-5-7-10(11)8-6-9;1-2-3(4)5/h5-8,11H,2-4H2,1H3;2H2,1H3,(H,4,5).
What are the key properties of 4-butylphenol;propanoic acid?
4-butylphenol;propanoic acid has a molecular weight of 224.30 g/mol, XLogP of 3.22, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butylphenol;propanoic acid is sourced from PubChem (CID 70308169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).