4-butylphenol;propanoic acid

C13H20O3 — CID 70308169

IUPAC4-butylphenol;propanoic acid
SMILESCCC(=O)O.CCCCc1ccc(O)cc1
InChIInChI=1S/C10H14O.C3H6O2/c1-2-3-4-9-5-7-10(11)8-6-9;1-2-3(4)5/h5-8,11H,2-4H2,1H3;2H2,1H3,(H,4,5)
InChIKeyRAUVKJQBNAXAMI-UHFFFAOYSA-N
MW224.30 g/mol
LogP3.22
Rot. Bonds4

About 4-butylphenol;propanoic acid

4-butylphenol;propanoic acid (PubChem CID 70308169) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is 4-butylphenol;propanoic acid.

Molecular Properties

Compound Name4-butylphenol;propanoic acid
PubChem CID70308169
Molecular FormulaC13H20O3
Molecular Weight224.30 g/mol
Exact Mass224.14
IUPAC Name4-butylphenol;propanoic acid
SMILESCCC(=O)O.CCCCc1ccc(O)cc1
InChIInChI=1S/C10H14O.C3H6O2/c1-2-3-4-9-5-7-10(11)8-6-9;1-2-3(4)5/h5-8,11H,2-4H2,1H3;2H2,1H3,(H,4,5)
InChIKeyRAUVKJQBNAXAMI-UHFFFAOYSA-N
XLogP3.22
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.30
LogP ≤ 53.22
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4-butylphenol;propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-butylphenol;propanoic acid?
The IUPAC name of 4-butylphenol;propanoic acid (CID 70308169) is 4-butylphenol;propanoic acid.
What is the SMILES notation for 4-butylphenol;propanoic acid?
The canonical SMILES for 4-butylphenol;propanoic acid is CCC(=O)O.CCCCc1ccc(O)cc1.
What is the InChIKey of 4-butylphenol;propanoic acid?
The InChIKey is RAUVKJQBNAXAMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O.C3H6O2/c1-2-3-4-9-5-7-10(11)8-6-9;1-2-3(4)5/h5-8,11H,2-4H2,1H3;2H2,1H3,(H,4,5).
What are the key properties of 4-butylphenol;propanoic acid?
4-butylphenol;propanoic acid has a molecular weight of 224.30 g/mol, XLogP of 3.22, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butylphenol;propanoic acid is sourced from PubChem (CID 70308169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).