About 4-butylphenol;tungsten
4-butylphenol;tungsten (PubChem CID 174758928) has the molecular formula C10H14OW
and a molecular weight of 334.06 g/mol. Its IUPAC name is 4-butylphenol;tungsten.
Molecular Properties
| Compound Name | 4-butylphenol;tungsten |
| PubChem CID | 174758928 |
| Molecular Formula | C10H14OW |
| Molecular Weight | 334.06 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 4-butylphenol;tungsten |
| SMILES | CCCCc1ccc(O)cc1.[W] |
| InChI | InChI=1S/C10H14O.W/c1-2-3-4-9-5-7-10(11)8-6-9;/h5-8,11H,2-4H2,1H3; |
| InChIKey | AOTNYADHNCTVFY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.06 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-butylphenol;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butylphenol;tungsten?
The IUPAC name of 4-butylphenol;tungsten (CID 174758928) is 4-butylphenol;tungsten.
What is the SMILES notation for 4-butylphenol;tungsten?
The canonical SMILES for 4-butylphenol;tungsten is CCCCc1ccc(O)cc1.[W].
What is the InChIKey of 4-butylphenol;tungsten?
The InChIKey is AOTNYADHNCTVFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O.W/c1-2-3-4-9-5-7-10(11)8-6-9;/h5-8,11H,2-4H2,1H3;.
What are the key properties of 4-butylphenol;tungsten?
4-butylphenol;tungsten has a molecular weight of 334.06 g/mol, XLogP of 2.73, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butylphenol;tungsten is sourced from PubChem (CID 174758928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).