About calcium;hydride;4-tetradecylphenol
calcium;hydride;4-tetradecylphenol (PubChem CID 174582359) has the molecular formula C20H36CaO
and a molecular weight of 332.58 g/mol. Its IUPAC name is calcium;hydride;4-tetradecylphenol.
Molecular Properties
| Compound Name | calcium;hydride;4-tetradecylphenol |
| PubChem CID | 174582359 |
| Molecular Formula | C20H36CaO |
| Molecular Weight | 332.58 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | calcium;hydride;4-tetradecylphenol |
| SMILES | CCCCCCCCCCCCCCc1ccc(O)cc1.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C20H34O.Ca.2H/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-19-15-17-20(21)18-16-19;;;/h15-18,21H,2-14H2,1H3;;;/q;+2;2*-1 |
| InChIKey | QANXCPAUVITYFO-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.58 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze calcium;hydride;4-tetradecylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;hydride;4-tetradecylphenol?
The IUPAC name of calcium;hydride;4-tetradecylphenol (CID 174582359) is calcium;hydride;4-tetradecylphenol.
What is the SMILES notation for calcium;hydride;4-tetradecylphenol?
The canonical SMILES for calcium;hydride;4-tetradecylphenol is CCCCCCCCCCCCCCc1ccc(O)cc1.[Ca+2].[H-].[H-].
What is the InChIKey of calcium;hydride;4-tetradecylphenol?
The InChIKey is QANXCPAUVITYFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34O.Ca.2H/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-19-15-17-20(21)18-16-19;;;/h15-18,21H,2-14H2,1H3;;;/q;+2;2*-1.
What are the key properties of calcium;hydride;4-tetradecylphenol?
calcium;hydride;4-tetradecylphenol has a molecular weight of 332.58 g/mol, XLogP of 6.48, 13 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;hydride;4-tetradecylphenol is sourced from PubChem (CID 174582359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).