About benzene-1,3-diol;4-dodecylphenol
benzene-1,3-diol;4-dodecylphenol (PubChem CID 159325714) has the molecular formula C24H36O3
and a molecular weight of 372.55 g/mol. Its IUPAC name is benzene-1,3-diol;4-dodecylphenol.
Molecular Properties
| Compound Name | benzene-1,3-diol;4-dodecylphenol |
| PubChem CID | 159325714 |
| Molecular Formula | C24H36O3 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | benzene-1,3-diol;4-dodecylphenol |
| SMILES | CCCCCCCCCCCCc1ccc(O)cc1.Oc1cccc(O)c1 |
| InChI | InChI=1S/C18H30O.C6H6O2/c1-2-3-4-5-6-7-8-9-10-11-12-17-13-15-18(19)16-14-17;7-5-2-1-3-6(8)4-5/h13-16,19H,2-12H2,1H3;1-4,7-8H |
| InChIKey | LEIKNYPPYVXJIC-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,3-diol;4-dodecylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,3-diol;4-dodecylphenol?
The IUPAC name of benzene-1,3-diol;4-dodecylphenol (CID 159325714) is benzene-1,3-diol;4-dodecylphenol.
What is the SMILES notation for benzene-1,3-diol;4-dodecylphenol?
The canonical SMILES for benzene-1,3-diol;4-dodecylphenol is CCCCCCCCCCCCc1ccc(O)cc1.Oc1cccc(O)c1.
What is the InChIKey of benzene-1,3-diol;4-dodecylphenol?
The InChIKey is LEIKNYPPYVXJIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30O.C6H6O2/c1-2-3-4-5-6-7-8-9-10-11-12-17-13-15-18(19)16-14-17;7-5-2-1-3-6(8)4-5/h13-16,19H,2-12H2,1H3;1-4,7-8H.
What are the key properties of benzene-1,3-diol;4-dodecylphenol?
benzene-1,3-diol;4-dodecylphenol has a molecular weight of 372.55 g/mol, XLogP of 6.95, 11 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,3-diol;4-dodecylphenol is sourced from PubChem (CID 159325714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).