About methanolate;nickel(3+);4-octylphenol
methanolate;nickel(3+);4-octylphenol (PubChem CID 159960852) has the molecular formula C17H31NiO4
and a molecular weight of 358.12 g/mol. Its IUPAC name is methanolate;nickel(3+);4-octylphenol.
Molecular Properties
| Compound Name | methanolate;nickel(3+);4-octylphenol |
| PubChem CID | 159960852 |
| Molecular Formula | C17H31NiO4 |
| Molecular Weight | 358.12 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | methanolate;nickel(3+);4-octylphenol |
| SMILES | CCCCCCCCc1ccc(O)cc1.C[O-].C[O-].C[O-].[Ni+3] |
| InChI | InChI=1S/C14H22O.3CH3O.Ni/c1-2-3-4-5-6-7-8-13-9-11-14(15)12-10-13;3*1-2;/h9-12,15H,2-8H2,1H3;3*1H3;/q;3*-1;+3 |
| InChIKey | FYZMBZLWLDPTBR-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 89.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.12 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methanolate;nickel(3+);4-octylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanolate;nickel(3+);4-octylphenol?
The IUPAC name of methanolate;nickel(3+);4-octylphenol (CID 159960852) is methanolate;nickel(3+);4-octylphenol.
What is the SMILES notation for methanolate;nickel(3+);4-octylphenol?
The canonical SMILES for methanolate;nickel(3+);4-octylphenol is CCCCCCCCc1ccc(O)cc1.C[O-].C[O-].C[O-].[Ni+3].
What is the InChIKey of methanolate;nickel(3+);4-octylphenol?
The InChIKey is FYZMBZLWLDPTBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O.3CH3O.Ni/c1-2-3-4-5-6-7-8-13-9-11-14(15)12-10-13;3*1-2;/h9-12,15H,2-8H2,1H3;3*1H3;/q;3*-1;+3.
What are the key properties of methanolate;nickel(3+);4-octylphenol?
methanolate;nickel(3+);4-octylphenol has a molecular weight of 358.12 g/mol, XLogP of 1.22, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanolate;nickel(3+);4-octylphenol is sourced from PubChem (CID 159960852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).