About 2-(2-hydroxyethoxy)ethanol;4-octylphenol
2-(2-hydroxyethoxy)ethanol;4-octylphenol (PubChem CID 158887559) has the molecular formula C18H32O4
and a molecular weight of 312.45 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethanol;4-octylphenol.
Molecular Properties
| Compound Name | 2-(2-hydroxyethoxy)ethanol;4-octylphenol |
| PubChem CID | 158887559 |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethanol;4-octylphenol |
| SMILES | CCCCCCCCc1ccc(O)cc1.OCCOCCO |
| InChI | InChI=1S/C14H22O.C4H10O3/c1-2-3-4-5-6-7-8-13-9-11-14(15)12-10-13;5-1-3-7-4-2-6/h9-12,15H,2-8H2,1H3;5-6H,1-4H2 |
| InChIKey | JDVASCOMAARWNV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-hydroxyethoxy)ethanol;4-octylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxyethoxy)ethanol;4-octylphenol?
The IUPAC name of 2-(2-hydroxyethoxy)ethanol;4-octylphenol (CID 158887559) is 2-(2-hydroxyethoxy)ethanol;4-octylphenol.
What is the SMILES notation for 2-(2-hydroxyethoxy)ethanol;4-octylphenol?
The canonical SMILES for 2-(2-hydroxyethoxy)ethanol;4-octylphenol is CCCCCCCCc1ccc(O)cc1.OCCOCCO.
What is the InChIKey of 2-(2-hydroxyethoxy)ethanol;4-octylphenol?
The InChIKey is JDVASCOMAARWNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O.C4H10O3/c1-2-3-4-5-6-7-8-13-9-11-14(15)12-10-13;5-1-3-7-4-2-6/h9-12,15H,2-8H2,1H3;5-6H,1-4H2.
What are the key properties of 2-(2-hydroxyethoxy)ethanol;4-octylphenol?
2-(2-hydroxyethoxy)ethanol;4-octylphenol has a molecular weight of 312.45 g/mol, XLogP of 3.28, 11 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxyethoxy)ethanol;4-octylphenol is sourced from PubChem (CID 158887559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).