About 2-hydroxyethyl dihydrogen phosphate;4-octylphenol
2-hydroxyethyl dihydrogen phosphate;4-octylphenol (PubChem CID 170173418) has the molecular formula C16H29O6P
and a molecular weight of 348.38 g/mol. Its IUPAC name is 2-hydroxyethyl dihydrogen phosphate;4-octylphenol.
Molecular Properties
| Compound Name | 2-hydroxyethyl dihydrogen phosphate;4-octylphenol |
| PubChem CID | 170173418 |
| Molecular Formula | C16H29O6P |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 2-hydroxyethyl dihydrogen phosphate;4-octylphenol |
| SMILES | CCCCCCCCc1ccc(O)cc1.O=P(O)(O)OCCO |
| InChI | InChI=1S/C14H22O.C2H7O5P/c1-2-3-4-5-6-7-8-13-9-11-14(15)12-10-13;3-1-2-7-8(4,5)6/h9-12,15H,2-8H2,1H3;3H,1-2H2,(H2,4,5,6) |
| InChIKey | QSFBSCBLQCCGMZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethyl dihydrogen phosphate;4-octylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl dihydrogen phosphate;4-octylphenol?
The IUPAC name of 2-hydroxyethyl dihydrogen phosphate;4-octylphenol (CID 170173418) is 2-hydroxyethyl dihydrogen phosphate;4-octylphenol.
What is the SMILES notation for 2-hydroxyethyl dihydrogen phosphate;4-octylphenol?
The canonical SMILES for 2-hydroxyethyl dihydrogen phosphate;4-octylphenol is CCCCCCCCc1ccc(O)cc1.O=P(O)(O)OCCO.
What is the InChIKey of 2-hydroxyethyl dihydrogen phosphate;4-octylphenol?
The InChIKey is QSFBSCBLQCCGMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O.C2H7O5P/c1-2-3-4-5-6-7-8-13-9-11-14(15)12-10-13;3-1-2-7-8(4,5)6/h9-12,15H,2-8H2,1H3;3H,1-2H2,(H2,4,5,6).
What are the key properties of 2-hydroxyethyl dihydrogen phosphate;4-octylphenol?
2-hydroxyethyl dihydrogen phosphate;4-octylphenol has a molecular weight of 348.38 g/mol, XLogP of 3.38, 10 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl dihydrogen phosphate;4-octylphenol is sourced from PubChem (CID 170173418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).