About calcium;hydride;4-octylphenol
calcium;hydride;4-octylphenol (PubChem CID 173256756) has the molecular formula C14H24CaO
and a molecular weight of 248.42 g/mol. Its IUPAC name is calcium;hydride;4-octylphenol.
Molecular Properties
| Compound Name | calcium;hydride;4-octylphenol |
| PubChem CID | 173256756 |
| Molecular Formula | C14H24CaO |
| Molecular Weight | 248.42 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | calcium;hydride;4-octylphenol |
| SMILES | CCCCCCCCc1ccc(O)cc1.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C14H22O.Ca.2H/c1-2-3-4-5-6-7-8-13-9-11-14(15)12-10-13;;;/h9-12,15H,2-8H2,1H3;;;/q;+2;2*-1 |
| InChIKey | CDQDGKMQXOXWCO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze calcium;hydride;4-octylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;hydride;4-octylphenol?
The IUPAC name of calcium;hydride;4-octylphenol (CID 173256756) is calcium;hydride;4-octylphenol.
What is the SMILES notation for calcium;hydride;4-octylphenol?
The canonical SMILES for calcium;hydride;4-octylphenol is CCCCCCCCc1ccc(O)cc1.[Ca+2].[H-].[H-].
What is the InChIKey of calcium;hydride;4-octylphenol?
The InChIKey is CDQDGKMQXOXWCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O.Ca.2H/c1-2-3-4-5-6-7-8-13-9-11-14(15)12-10-13;;;/h9-12,15H,2-8H2,1H3;;;/q;+2;2*-1.
What are the key properties of calcium;hydride;4-octylphenol?
calcium;hydride;4-octylphenol has a molecular weight of 248.42 g/mol, XLogP of 4.14, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;hydride;4-octylphenol is sourced from PubChem (CID 173256756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).