About barium(2+);hydride;4-nonylphenol
barium(2+);hydride;4-nonylphenol (PubChem CID 173156845) has the molecular formula C15H26BaO
and a molecular weight of 359.70 g/mol. Its IUPAC name is barium(2+);hydride;4-nonylphenol.
Molecular Properties
| Compound Name | barium(2+);hydride;4-nonylphenol |
| PubChem CID | 173156845 |
| Molecular Formula | C15H26BaO |
| Molecular Weight | 359.70 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | barium(2+);hydride;4-nonylphenol |
| SMILES | CCCCCCCCCc1ccc(O)cc1.[Ba+2].[H-].[H-] |
| InChI | InChI=1S/C15H24O.Ba.2H/c1-2-3-4-5-6-7-8-9-14-10-12-15(16)13-11-14;;;/h10-13,16H,2-9H2,1H3;;;/q;+2;2*-1 |
| InChIKey | HWKLNWZMBBVHDW-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.70 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze barium(2+);hydride;4-nonylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);hydride;4-nonylphenol?
The IUPAC name of barium(2+);hydride;4-nonylphenol (CID 173156845) is barium(2+);hydride;4-nonylphenol.
What is the SMILES notation for barium(2+);hydride;4-nonylphenol?
The canonical SMILES for barium(2+);hydride;4-nonylphenol is CCCCCCCCCc1ccc(O)cc1.[Ba+2].[H-].[H-].
What is the InChIKey of barium(2+);hydride;4-nonylphenol?
The InChIKey is HWKLNWZMBBVHDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O.Ba.2H/c1-2-3-4-5-6-7-8-9-14-10-12-15(16)13-11-14;;;/h10-13,16H,2-9H2,1H3;;;/q;+2;2*-1.
What are the key properties of barium(2+);hydride;4-nonylphenol?
barium(2+);hydride;4-nonylphenol has a molecular weight of 359.70 g/mol, XLogP of 4.53, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);hydride;4-nonylphenol is sourced from PubChem (CID 173156845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).