About sodium;hydrogen sulfite;4-nonylphenol
sodium;hydrogen sulfite;4-nonylphenol (PubChem CID 174890195) has the molecular formula C15H25NaO4S
and a molecular weight of 324.42 g/mol. Its IUPAC name is sodium;hydrogen sulfite;4-nonylphenol.
Molecular Properties
| Compound Name | sodium;hydrogen sulfite;4-nonylphenol |
| PubChem CID | 174890195 |
| Molecular Formula | C15H25NaO4S |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | sodium;hydrogen sulfite;4-nonylphenol |
| SMILES | CCCCCCCCCc1ccc(O)cc1.O=S([O-])O.[Na+] |
| InChI | InChI=1S/C15H24O.Na.H2O3S/c1-2-3-4-5-6-7-8-9-14-10-12-15(16)13-11-14;;1-4(2)3/h10-13,16H,2-9H2,1H3;;(H2,1,2,3)/q;+1;/p-1 |
| InChIKey | CVURVVHLHGVSSC-UHFFFAOYSA-M |
| XLogP | 1.03 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydrogen sulfite;4-nonylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydrogen sulfite;4-nonylphenol?
The IUPAC name of sodium;hydrogen sulfite;4-nonylphenol (CID 174890195) is sodium;hydrogen sulfite;4-nonylphenol.
What is the SMILES notation for sodium;hydrogen sulfite;4-nonylphenol?
The canonical SMILES for sodium;hydrogen sulfite;4-nonylphenol is CCCCCCCCCc1ccc(O)cc1.O=S([O-])O.[Na+].
What is the InChIKey of sodium;hydrogen sulfite;4-nonylphenol?
The InChIKey is CVURVVHLHGVSSC-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H24O.Na.H2O3S/c1-2-3-4-5-6-7-8-9-14-10-12-15(16)13-11-14;;1-4(2)3/h10-13,16H,2-9H2,1H3;;(H2,1,2,3)/q;+1;/p-1.
What are the key properties of sodium;hydrogen sulfite;4-nonylphenol?
sodium;hydrogen sulfite;4-nonylphenol has a molecular weight of 324.42 g/mol, XLogP of 1.03, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydrogen sulfite;4-nonylphenol is sourced from PubChem (CID 174890195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).