About sodium 4-octylbenzenesulfinate
sodium 4-octylbenzenesulfinate (PubChem CID 23714330) has the molecular formula C14H21NaO2S
and a molecular weight of 276.38 g/mol. Its IUPAC name is sodium 4-octylbenzenesulfinate.
Molecular Properties
| Compound Name | sodium 4-octylbenzenesulfinate |
| PubChem CID | 23714330 |
| Molecular Formula | C14H21NaO2S |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | sodium 4-octylbenzenesulfinate |
| SMILES | CCCCCCCCc1ccc(S(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C14H22O2S.Na/c1-2-3-4-5-6-7-8-13-9-11-14(12-10-13)17(15)16;/h9-12H,2-8H2,1H3,(H,15,16);/q;+1/p-1 |
| InChIKey | CSZRTTCJJXGZBQ-UHFFFAOYSA-M |
| XLogP | 0.83 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze sodium 4-octylbenzenesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 4-octylbenzenesulfinate?
The IUPAC name of sodium 4-octylbenzenesulfinate (CID 23714330) is sodium 4-octylbenzenesulfinate.
What is the SMILES notation for sodium 4-octylbenzenesulfinate?
The canonical SMILES for sodium 4-octylbenzenesulfinate is CCCCCCCCc1ccc(S(=O)[O-])cc1.[Na+].
What is the InChIKey of sodium 4-octylbenzenesulfinate?
The InChIKey is CSZRTTCJJXGZBQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H22O2S.Na/c1-2-3-4-5-6-7-8-13-9-11-14(12-10-13)17(15)16;/h9-12H,2-8H2,1H3,(H,15,16);/q;+1/p-1.
What are the key properties of sodium 4-octylbenzenesulfinate?
sodium 4-octylbenzenesulfinate has a molecular weight of 276.38 g/mol, XLogP of 0.83, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 4-octylbenzenesulfinate is sourced from PubChem (CID 23714330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).