About 1-butyl-4-nonylbenzene
1-butyl-4-nonylbenzene (PubChem CID 59545302) has the molecular formula C19H32
and a molecular weight of 260.46 g/mol. Its IUPAC name is 1-butyl-4-nonylbenzene.
Molecular Properties
| Compound Name | 1-butyl-4-nonylbenzene |
| PubChem CID | 59545302 |
| Molecular Formula | C19H32 |
| Molecular Weight | 260.46 g/mol |
| Exact Mass | 260.25 |
| IUPAC Name | 1-butyl-4-nonylbenzene |
| SMILES | CCCCCCCCCc1ccc(CCCC)cc1 |
| InChI | InChI=1S/C19H32/c1-3-5-7-8-9-10-11-13-19-16-14-18(15-17-19)12-6-4-2/h14-17H,3-13H2,1-2H3 |
| InChIKey | TZEIATBWLQWDLR-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 260.46 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-4-nonylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-4-nonylbenzene?
The IUPAC name of 1-butyl-4-nonylbenzene (CID 59545302) is 1-butyl-4-nonylbenzene.
What is the SMILES notation for 1-butyl-4-nonylbenzene?
The canonical SMILES for 1-butyl-4-nonylbenzene is CCCCCCCCCc1ccc(CCCC)cc1.
What is the InChIKey of 1-butyl-4-nonylbenzene?
The InChIKey is TZEIATBWLQWDLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32/c1-3-5-7-8-9-10-11-13-19-16-14-18(15-17-19)12-6-4-2/h14-17H,3-13H2,1-2H3.
What are the key properties of 1-butyl-4-nonylbenzene?
1-butyl-4-nonylbenzene has a molecular weight of 260.46 g/mol, XLogP of 6.32, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-4-nonylbenzene is sourced from PubChem (CID 59545302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).