About 1-bromo-4-dodecylbenzene
1-bromo-4-dodecylbenzene (PubChem CID 15120506) has the molecular formula C18H29Br
and a molecular weight of 325.33 g/mol. Its IUPAC name is 1-bromo-4-dodecylbenzene.
Molecular Properties
| Compound Name | 1-bromo-4-dodecylbenzene |
| PubChem CID | 15120506 |
| Molecular Formula | C18H29Br |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 1-bromo-4-dodecylbenzene |
| SMILES | CCCCCCCCCCCCc1ccc(Br)cc1 |
| InChI | InChI=1S/C18H29Br/c1-2-3-4-5-6-7-8-9-10-11-12-17-13-15-18(19)16-14-17/h13-16H,2-12H2,1H3 |
| InChIKey | RFFMRBISTZHCNY-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4-dodecylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-dodecylbenzene?
The IUPAC name of 1-bromo-4-dodecylbenzene (CID 15120506) is 1-bromo-4-dodecylbenzene.
What is the SMILES notation for 1-bromo-4-dodecylbenzene?
The canonical SMILES for 1-bromo-4-dodecylbenzene is CCCCCCCCCCCCc1ccc(Br)cc1.
What is the InChIKey of 1-bromo-4-dodecylbenzene?
The InChIKey is RFFMRBISTZHCNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29Br/c1-2-3-4-5-6-7-8-9-10-11-12-17-13-15-18(19)16-14-17/h13-16H,2-12H2,1H3.
What are the key properties of 1-bromo-4-dodecylbenzene?
1-bromo-4-dodecylbenzene has a molecular weight of 325.33 g/mol, XLogP of 6.91, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-dodecylbenzene is sourced from PubChem (CID 15120506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).