C27H25Br2N3 — CID 59147599
2,4-bis(4-bromophenyl)-6-(4-hexylphenyl)-1,3,5-triazine (PubChem CID 59147599) has the molecular formula C27H25Br2N3 and a molecular weight of 551.33 g/mol. Its IUPAC name is 2,4-bis(4-bromophenyl)-6-(4-hexylphenyl)-1,3,5-triazine.
| Compound Name | 2,4-bis(4-bromophenyl)-6-(4-hexylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 59147599 |
| Molecular Formula | C27H25Br2N3 |
| Molecular Weight | 551.33 g/mol |
| Exact Mass | 549.04 |
| IUPAC Name | 2,4-bis(4-bromophenyl)-6-(4-hexylphenyl)-1,3,5-triazine |
| SMILES | CCCCCCc1ccc(-c2nc(-c3ccc(Br)cc3)nc(-c3ccc(Br)cc3)n2)cc1 |
| InChI | InChI=1S/C27H25Br2N3/c1-2-3-4-5-6-19-7-9-20(10-8-19)25-30-26(21-11-15-23(28)16-12-21)32-27(31-25)22-13-17-24(29)18-14-22/h7-18H,2-6H2,1H3 |
| InChIKey | RQSSYSFMBKYLLU-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.33 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|