About sodium 4-pentylbenzenesulfinate
sodium 4-pentylbenzenesulfinate (PubChem CID 23714332) has the molecular formula C11H15NaO2S
and a molecular weight of 234.30 g/mol. Its IUPAC name is sodium 4-pentylbenzenesulfinate.
Molecular Properties
| Compound Name | sodium 4-pentylbenzenesulfinate |
| PubChem CID | 23714332 |
| Molecular Formula | C11H15NaO2S |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | sodium 4-pentylbenzenesulfinate |
| SMILES | CCCCCc1ccc(S(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C11H16O2S.Na/c1-2-3-4-5-10-6-8-11(9-7-10)14(12)13;/h6-9H,2-5H2,1H3,(H,12,13);/q;+1/p-1 |
| InChIKey | IGWVBJLSRNJFOS-UHFFFAOYSA-M |
| XLogP | -0.34 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze sodium 4-pentylbenzenesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 4-pentylbenzenesulfinate?
The IUPAC name of sodium 4-pentylbenzenesulfinate (CID 23714332) is sodium 4-pentylbenzenesulfinate.
What is the SMILES notation for sodium 4-pentylbenzenesulfinate?
The canonical SMILES for sodium 4-pentylbenzenesulfinate is CCCCCc1ccc(S(=O)[O-])cc1.[Na+].
What is the InChIKey of sodium 4-pentylbenzenesulfinate?
The InChIKey is IGWVBJLSRNJFOS-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H16O2S.Na/c1-2-3-4-5-10-6-8-11(9-7-10)14(12)13;/h6-9H,2-5H2,1H3,(H,12,13);/q;+1/p-1.
What are the key properties of sodium 4-pentylbenzenesulfinate?
sodium 4-pentylbenzenesulfinate has a molecular weight of 234.30 g/mol, XLogP of -0.34, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 4-pentylbenzenesulfinate is sourced from PubChem (CID 23714332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).