About potassium;hydride;(4-pentadecylphenyl) sulfite
potassium;hydride;(4-pentadecylphenyl) sulfite (PubChem CID 174478368) has the molecular formula C21H36KO3S-
and a molecular weight of 407.68 g/mol. Its IUPAC name is potassium;hydride;(4-pentadecylphenyl) sulfite.
Molecular Properties
| Compound Name | potassium;hydride;(4-pentadecylphenyl) sulfite |
| PubChem CID | 174478368 |
| Molecular Formula | C21H36KO3S- |
| Molecular Weight | 407.68 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | potassium;hydride;(4-pentadecylphenyl) sulfite |
| SMILES | CCCCCCCCCCCCCCCc1ccc(OS(=O)[O-])cc1.[H-].[K+] |
| InChI | InChI=1S/C21H36O3S.K.H/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-20-16-18-21(19-17-20)24-25(22)23;;/h16-19H,2-15H2,1H3,(H,22,23);;/q;+1;-1/p-1 |
| InChIKey | LEFASOGJLNYRDM-UHFFFAOYSA-M |
| XLogP | 3.61 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.68 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze potassium;hydride;(4-pentadecylphenyl) sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydride;(4-pentadecylphenyl) sulfite?
The IUPAC name of potassium;hydride;(4-pentadecylphenyl) sulfite (CID 174478368) is potassium;hydride;(4-pentadecylphenyl) sulfite.
What is the SMILES notation for potassium;hydride;(4-pentadecylphenyl) sulfite?
The canonical SMILES for potassium;hydride;(4-pentadecylphenyl) sulfite is CCCCCCCCCCCCCCCc1ccc(OS(=O)[O-])cc1.[H-].[K+].
What is the InChIKey of potassium;hydride;(4-pentadecylphenyl) sulfite?
The InChIKey is LEFASOGJLNYRDM-UHFFFAOYSA-M. The full InChI is InChI=1S/C21H36O3S.K.H/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-20-16-18-21(19-17-20)24-25(22)23;;/h16-19H,2-15H2,1H3,(H,22,23);;/q;+1;-1/p-1.
What are the key properties of potassium;hydride;(4-pentadecylphenyl) sulfite?
potassium;hydride;(4-pentadecylphenyl) sulfite has a molecular weight of 407.68 g/mol, XLogP of 3.61, 16 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;(4-pentadecylphenyl) sulfite is sourced from PubChem (CID 174478368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).