About benzene-1,3-diol;4-nonylphenol
benzene-1,3-diol;4-nonylphenol (PubChem CID 159380657) has the molecular formula C21H30O3
and a molecular weight of 330.47 g/mol. Its IUPAC name is benzene-1,3-diol;4-nonylphenol.
Molecular Properties
| Compound Name | benzene-1,3-diol;4-nonylphenol |
| PubChem CID | 159380657 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | benzene-1,3-diol;4-nonylphenol |
| SMILES | CCCCCCCCCc1ccc(O)cc1.Oc1cccc(O)c1 |
| InChI | InChI=1S/C15H24O.C6H6O2/c1-2-3-4-5-6-7-8-9-14-10-12-15(16)13-11-14;7-5-2-1-3-6(8)4-5/h10-13,16H,2-9H2,1H3;1-4,7-8H |
| InChIKey | LKWAEOVYQGJYGY-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,3-diol;4-nonylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,3-diol;4-nonylphenol?
The IUPAC name of benzene-1,3-diol;4-nonylphenol (CID 159380657) is benzene-1,3-diol;4-nonylphenol.
What is the SMILES notation for benzene-1,3-diol;4-nonylphenol?
The canonical SMILES for benzene-1,3-diol;4-nonylphenol is CCCCCCCCCc1ccc(O)cc1.Oc1cccc(O)c1.
What is the InChIKey of benzene-1,3-diol;4-nonylphenol?
The InChIKey is LKWAEOVYQGJYGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O.C6H6O2/c1-2-3-4-5-6-7-8-9-14-10-12-15(16)13-11-14;7-5-2-1-3-6(8)4-5/h10-13,16H,2-9H2,1H3;1-4,7-8H.
What are the key properties of benzene-1,3-diol;4-nonylphenol?
benzene-1,3-diol;4-nonylphenol has a molecular weight of 330.47 g/mol, XLogP of 5.78, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,3-diol;4-nonylphenol is sourced from PubChem (CID 159380657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).