C16H18O — CID 174398804
bicyclo[3.1.0]hexa-1(6),2,4-triene;4-butylphenol (PubChem CID 174398804) has the molecular formula C16H18O and a molecular weight of 226.32 g/mol. Its IUPAC name is bicyclo[3.1.0]hexa-1(6),2,4-triene;4-butylphenol.
| Compound Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;4-butylphenol |
|---|---|
| PubChem CID | 174398804 |
| Molecular Formula | C16H18O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;4-butylphenol |
| SMILES | CCCCc1ccc(O)cc1.c1cc2cc-2c1 |
| InChI | InChI=1S/C10H14O.C6H4/c1-2-3-4-9-5-7-10(11)8-6-9;1-2-5-4-6(5)3-1/h5-8,11H,2-4H2,1H3;1-4H |
| InChIKey | JOPGFBKPQIOTIT-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |