C17H20O — CID 174345319
4-butylphenol;3-methylbicyclo[3.1.0]hexa-1(6),2,4-triene (PubChem CID 174345319) has the molecular formula C17H20O and a molecular weight of 240.35 g/mol. Its IUPAC name is 4-butylphenol;3-methylbicyclo[3.1.0]hexa-1(6),2,4-triene.
| Compound Name | 4-butylphenol;3-methylbicyclo[3.1.0]hexa-1(6),2,4-triene |
|---|---|
| PubChem CID | 174345319 |
| Molecular Formula | C17H20O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 4-butylphenol;3-methylbicyclo[3.1.0]hexa-1(6),2,4-triene |
| SMILES | CCCCc1ccc(O)cc1.Cc1cc2cc-2c1 |
| InChI | InChI=1S/C10H14O.C7H6/c1-2-3-4-9-5-7-10(11)8-6-9;1-5-2-6-4-7(6)3-5/h5-8,11H,2-4H2,1H3;2-4H,1H3 |
| InChIKey | DAAKZOYABFSKOR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |