C20H26O — CID 174342857
4-heptylphenol;3-methylbicyclo[3.1.0]hexa-1(6),2,4-triene (PubChem CID 174342857) has the molecular formula C20H26O and a molecular weight of 282.43 g/mol. Its IUPAC name is 4-heptylphenol;3-methylbicyclo[3.1.0]hexa-1(6),2,4-triene.
| Compound Name | 4-heptylphenol;3-methylbicyclo[3.1.0]hexa-1(6),2,4-triene |
|---|---|
| PubChem CID | 174342857 |
| Molecular Formula | C20H26O |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | 4-heptylphenol;3-methylbicyclo[3.1.0]hexa-1(6),2,4-triene |
| SMILES | CCCCCCCc1ccc(O)cc1.Cc1cc2cc-2c1 |
| InChI | InChI=1S/C13H20O.C7H6/c1-2-3-4-5-6-7-12-8-10-13(14)11-9-12;1-5-2-6-4-7(6)3-5/h8-11,14H,2-7H2,1H3;2-4H,1H3 |
| InChIKey | GTCSSNVQZTZRPZ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|