About 1-butyl-4-methylbenzene;phenol
1-butyl-4-methylbenzene;phenol (PubChem CID 174834955) has the molecular formula C17H22O
and a molecular weight of 242.36 g/mol. Its IUPAC name is 1-butyl-4-methylbenzene;phenol.
Molecular Properties
| Compound Name | 1-butyl-4-methylbenzene;phenol |
| PubChem CID | 174834955 |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 1-butyl-4-methylbenzene;phenol |
| SMILES | CCCCc1ccc(C)cc1.Oc1ccccc1 |
| InChI | InChI=1S/C11H16.C6H6O/c1-3-4-5-11-8-6-10(2)7-9-11;7-6-4-2-1-3-5-6/h6-9H,3-5H2,1-2H3;1-5,7H |
| InChIKey | FLBFCIZPFLTLOS-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-butyl-4-methylbenzene;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-4-methylbenzene;phenol?
The IUPAC name of 1-butyl-4-methylbenzene;phenol (CID 174834955) is 1-butyl-4-methylbenzene;phenol.
What is the SMILES notation for 1-butyl-4-methylbenzene;phenol?
The canonical SMILES for 1-butyl-4-methylbenzene;phenol is CCCCc1ccc(C)cc1.Oc1ccccc1.
What is the InChIKey of 1-butyl-4-methylbenzene;phenol?
The InChIKey is FLBFCIZPFLTLOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16.C6H6O/c1-3-4-5-11-8-6-10(2)7-9-11;7-6-4-2-1-3-5-6/h6-9H,3-5H2,1-2H3;1-5,7H.
What are the key properties of 1-butyl-4-methylbenzene;phenol?
1-butyl-4-methylbenzene;phenol has a molecular weight of 242.36 g/mol, XLogP of 4.73, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-4-methylbenzene;phenol is sourced from PubChem (CID 174834955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).