About 4-butylbenzene-1,2-diol;phenol
4-butylbenzene-1,2-diol;phenol (PubChem CID 170169190) has the molecular formula C16H20O3
and a molecular weight of 260.33 g/mol. Its IUPAC name is 4-butylbenzene-1,2-diol;phenol.
Molecular Properties
| Compound Name | 4-butylbenzene-1,2-diol;phenol |
| PubChem CID | 170169190 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 4-butylbenzene-1,2-diol;phenol |
| SMILES | CCCCc1ccc(O)c(O)c1.Oc1ccccc1 |
| InChI | InChI=1S/C10H14O2.C6H6O/c1-2-3-4-8-5-6-9(11)10(12)7-8;7-6-4-2-1-3-5-6/h5-7,11-12H,2-4H2,1H3;1-5,7H |
| InChIKey | FSKYTIKEHRIKRJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4-butylbenzene-1,2-diol;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butylbenzene-1,2-diol;phenol?
The IUPAC name of 4-butylbenzene-1,2-diol;phenol (CID 170169190) is 4-butylbenzene-1,2-diol;phenol.
What is the SMILES notation for 4-butylbenzene-1,2-diol;phenol?
The canonical SMILES for 4-butylbenzene-1,2-diol;phenol is CCCCc1ccc(O)c(O)c1.Oc1ccccc1.
What is the InChIKey of 4-butylbenzene-1,2-diol;phenol?
The InChIKey is FSKYTIKEHRIKRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2.C6H6O/c1-2-3-4-8-5-6-9(11)10(12)7-8;7-6-4-2-1-3-5-6/h5-7,11-12H,2-4H2,1H3;1-5,7H.
What are the key properties of 4-butylbenzene-1,2-diol;phenol?
4-butylbenzene-1,2-diol;phenol has a molecular weight of 260.33 g/mol, XLogP of 3.83, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butylbenzene-1,2-diol;phenol is sourced from PubChem (CID 170169190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).