C16H18O2 — CID 15135539
4-(4-phenylbutyl)benzene-1,2-diol (PubChem CID 15135539) has the molecular formula C16H18O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is 4-(4-phenylbutyl)benzene-1,2-diol.
| Compound Name | 4-(4-phenylbutyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 15135539 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 4-(4-phenylbutyl)benzene-1,2-diol |
| SMILES | Oc1ccc(CCCCc2ccccc2)cc1O |
| InChI | InChI=1S/C16H18O2/c17-15-11-10-14(12-16(15)18)9-5-4-8-13-6-2-1-3-7-13/h1-3,6-7,10-12,17-18H,4-5,8-9H2 |
| InChIKey | PEMMCHVJDAVCMU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|