C22H22O4 — CID 57182944
4-[4-(3,4-dihydroxyphenyl)-4-phenylbutyl]benzene-1,2-diol (PubChem CID 57182944) has the molecular formula C22H22O4 and a molecular weight of 350.41 g/mol. Its IUPAC name is 4-[4-(3,4-dihydroxyphenyl)-4-phenylbutyl]benzene-1,2-diol.
| Compound Name | 4-[4-(3,4-dihydroxyphenyl)-4-phenylbutyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 57182944 |
| Molecular Formula | C22H22O4 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 4-[4-(3,4-dihydroxyphenyl)-4-phenylbutyl]benzene-1,2-diol |
| SMILES | Oc1ccc(CCCC(c2ccccc2)c2ccc(O)c(O)c2)cc1O |
| InChI | InChI=1S/C22H22O4/c23-19-11-9-15(13-21(19)25)5-4-8-18(16-6-2-1-3-7-16)17-10-12-20(24)22(26)14-17/h1-3,6-7,9-14,18,23-26H,4-5,8H2 |
| InChIKey | JOCQTITZJJSGGD-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|