C22H22O3 — CID 56999686
4-[4,4-bis(4-hydroxyphenyl)butyl]phenol (PubChem CID 56999686) has the molecular formula C22H22O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is 4-[4,4-bis(4-hydroxyphenyl)butyl]phenol.
| Compound Name | 4-[4,4-bis(4-hydroxyphenyl)butyl]phenol |
|---|---|
| PubChem CID | 56999686 |
| Molecular Formula | C22H22O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 4-[4,4-bis(4-hydroxyphenyl)butyl]phenol |
| SMILES | Oc1ccc(CCCC(c2ccc(O)cc2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C22H22O3/c23-19-10-4-16(5-11-19)2-1-3-22(17-6-12-20(24)13-7-17)18-8-14-21(25)15-9-18/h4-15,22-25H,1-3H2 |
| InChIKey | CYHIEYGJKUMMSY-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |