C35H40O4 — CID 57252582
4-[1,11,11-tris(4-hydroxyphenyl)undecyl]phenol (PubChem CID 57252582) has the molecular formula C35H40O4 and a molecular weight of 524.70 g/mol. Its IUPAC name is 4-[1,11,11-tris(4-hydroxyphenyl)undecyl]phenol.
| Compound Name | 4-[1,11,11-tris(4-hydroxyphenyl)undecyl]phenol |
|---|---|
| PubChem CID | 57252582 |
| Molecular Formula | C35H40O4 |
| Molecular Weight | 524.70 g/mol |
| Exact Mass | 524.29 |
| IUPAC Name | 4-[1,11,11-tris(4-hydroxyphenyl)undecyl]phenol |
| SMILES | Oc1ccc(C(CCCCCCCCCC(c2ccc(O)cc2)c2ccc(O)cc2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C35H40O4/c36-30-18-10-26(11-19-30)34(27-12-20-31(37)21-13-27)8-6-4-2-1-3-5-7-9-35(28-14-22-32(38)23-15-28)29-16-24-33(39)25-17-29/h10-25,34-39H,1-9H2 |
| InChIKey | FNOMEIATPSCBPN-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.70 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|