About 4-dodecan-3-ylphenol
4-dodecan-3-ylphenol (PubChem CID 12820022) has the molecular formula C18H30O
and a molecular weight of 262.44 g/mol. Its IUPAC name is 4-dodecan-3-ylphenol.
Molecular Properties
| Compound Name | 4-dodecan-3-ylphenol |
| PubChem CID | 12820022 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | 4-dodecan-3-ylphenol |
| SMILES | CCCCCCCCCC(CC)c1ccc(O)cc1 |
| InChI | InChI=1S/C18H30O/c1-3-5-6-7-8-9-10-11-16(4-2)17-12-14-18(19)15-13-17/h12-16,19H,3-11H2,1-2H3 |
| InChIKey | HGAKIBMVKBKOFG-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-dodecan-3-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-dodecan-3-ylphenol?
The IUPAC name of 4-dodecan-3-ylphenol (CID 12820022) is 4-dodecan-3-ylphenol.
What is the SMILES notation for 4-dodecan-3-ylphenol?
The canonical SMILES for 4-dodecan-3-ylphenol is CCCCCCCCCC(CC)c1ccc(O)cc1.
What is the InChIKey of 4-dodecan-3-ylphenol?
The InChIKey is HGAKIBMVKBKOFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30O/c1-3-5-6-7-8-9-10-11-16(4-2)17-12-14-18(19)15-13-17/h12-16,19H,3-11H2,1-2H3.
What are the key properties of 4-dodecan-3-ylphenol?
4-dodecan-3-ylphenol has a molecular weight of 262.44 g/mol, XLogP of 6.03, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-dodecan-3-ylphenol is sourced from PubChem (CID 12820022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).