About 4-[1-(4-hydroxyphenyl)propyl]phenol;undecane
4-[1-(4-hydroxyphenyl)propyl]phenol;undecane (PubChem CID 174905836) has the molecular formula C26H40O2
and a molecular weight of 384.60 g/mol. Its IUPAC name is 4-[1-(4-hydroxyphenyl)propyl]phenol;undecane.
Molecular Properties
| Compound Name | 4-[1-(4-hydroxyphenyl)propyl]phenol;undecane |
| PubChem CID | 174905836 |
| Molecular Formula | C26H40O2 |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 384.30 |
| IUPAC Name | 4-[1-(4-hydroxyphenyl)propyl]phenol;undecane |
| SMILES | CCC(c1ccc(O)cc1)c1ccc(O)cc1.CCCCCCCCCCC |
| InChI | InChI=1S/C15H16O2.C11H24/c1-2-15(11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12;1-3-5-7-9-11-10-8-6-4-2/h3-10,15-17H,2H2,1H3;3-11H2,1-2H3 |
| InChIKey | DCGLVGMLOOIVKE-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[1-(4-hydroxyphenyl)propyl]phenol;undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(4-hydroxyphenyl)propyl]phenol;undecane?
The IUPAC name of 4-[1-(4-hydroxyphenyl)propyl]phenol;undecane (CID 174905836) is 4-[1-(4-hydroxyphenyl)propyl]phenol;undecane.
What is the SMILES notation for 4-[1-(4-hydroxyphenyl)propyl]phenol;undecane?
The canonical SMILES for 4-[1-(4-hydroxyphenyl)propyl]phenol;undecane is CCC(c1ccc(O)cc1)c1ccc(O)cc1.CCCCCCCCCCC.
What is the InChIKey of 4-[1-(4-hydroxyphenyl)propyl]phenol;undecane?
The InChIKey is DCGLVGMLOOIVKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O2.C11H24/c1-2-15(11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12;1-3-5-7-9-11-10-8-6-4-2/h3-10,15-17H,2H2,1H3;3-11H2,1-2H3.
What are the key properties of 4-[1-(4-hydroxyphenyl)propyl]phenol;undecane?
4-[1-(4-hydroxyphenyl)propyl]phenol;undecane has a molecular weight of 384.60 g/mol, XLogP of 8.18, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(4-hydroxyphenyl)propyl]phenol;undecane is sourced from PubChem (CID 174905836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).