About 4-hexan-2-ylphenol
4-hexan-2-ylphenol (PubChem CID 12579179) has the molecular formula C12H18O
and a molecular weight of 178.27 g/mol. Its IUPAC name is 4-hexan-2-ylphenol.
Molecular Properties
| Compound Name | 4-hexan-2-ylphenol |
| PubChem CID | 12579179 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 4-hexan-2-ylphenol |
| SMILES | CCCCC(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C12H18O/c1-3-4-5-10(2)11-6-8-12(13)9-7-11/h6-10,13H,3-5H2,1-2H3 |
| InChIKey | LHGKXJSWQDLKEA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-hexan-2-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hexan-2-ylphenol?
The IUPAC name of 4-hexan-2-ylphenol (CID 12579179) is 4-hexan-2-ylphenol.
What is the SMILES notation for 4-hexan-2-ylphenol?
The canonical SMILES for 4-hexan-2-ylphenol is CCCCC(C)c1ccc(O)cc1.
What is the InChIKey of 4-hexan-2-ylphenol?
The InChIKey is LHGKXJSWQDLKEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O/c1-3-4-5-10(2)11-6-8-12(13)9-7-11/h6-10,13H,3-5H2,1-2H3.
What are the key properties of 4-hexan-2-ylphenol?
4-hexan-2-ylphenol has a molecular weight of 178.27 g/mol, XLogP of 3.69, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hexan-2-ylphenol is sourced from PubChem (CID 12579179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).