About 4-undecan-6-ylphenol
4-undecan-6-ylphenol (PubChem CID 66867197) has the molecular formula C17H28O
and a molecular weight of 248.41 g/mol. Its IUPAC name is 4-undecan-6-ylphenol.
Molecular Properties
| Compound Name | 4-undecan-6-ylphenol |
| PubChem CID | 66867197 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | 4-undecan-6-ylphenol |
| SMILES | CCCCCC(CCCCC)c1ccc(O)cc1 |
| InChI | InChI=1S/C17H28O/c1-3-5-7-9-15(10-8-6-4-2)16-11-13-17(18)14-12-16/h11-15,18H,3-10H2,1-2H3 |
| InChIKey | YKIWRKHFGXZSNF-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-undecan-6-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-undecan-6-ylphenol?
The IUPAC name of 4-undecan-6-ylphenol (CID 66867197) is 4-undecan-6-ylphenol.
What is the SMILES notation for 4-undecan-6-ylphenol?
The canonical SMILES for 4-undecan-6-ylphenol is CCCCCC(CCCCC)c1ccc(O)cc1.
What is the InChIKey of 4-undecan-6-ylphenol?
The InChIKey is YKIWRKHFGXZSNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O/c1-3-5-7-9-15(10-8-6-4-2)16-11-13-17(18)14-12-16/h11-15,18H,3-10H2,1-2H3.
What are the key properties of 4-undecan-6-ylphenol?
4-undecan-6-ylphenol has a molecular weight of 248.41 g/mol, XLogP of 5.64, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-undecan-6-ylphenol is sourced from PubChem (CID 66867197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).