C40H52N2 — CID 22919612
4-[1-[4-[1-[4-[1-(4-aminophenyl)propyl]phenyl]decyl]phenyl]propyl]aniline (PubChem CID 22919612) has the molecular formula C40H52N2 and a molecular weight of 560.87 g/mol. Its IUPAC name is 4-[1-[4-[1-[4-[1-(4-aminophenyl)propyl]phenyl]decyl]phenyl]propyl]aniline.
| Compound Name | 4-[1-[4-[1-[4-[1-(4-aminophenyl)propyl]phenyl]decyl]phenyl]propyl]aniline |
|---|---|
| PubChem CID | 22919612 |
| Molecular Formula | C40H52N2 |
| Molecular Weight | 560.87 g/mol |
| Exact Mass | 560.41 |
| IUPAC Name | 4-[1-[4-[1-[4-[1-(4-aminophenyl)propyl]phenyl]decyl]phenyl]propyl]aniline |
| SMILES | CCCCCCCCCC(c1ccc(C(CC)c2ccc(N)cc2)cc1)c1ccc(C(CC)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C40H52N2/c1-4-7-8-9-10-11-12-13-40(34-18-14-30(15-19-34)38(5-2)32-22-26-36(41)27-23-32)35-20-16-31(17-21-35)39(6-3)33-24-28-37(42)29-25-33/h14-29,38-40H,4-13,41-42H2,1-3H3 |
| InChIKey | MWKKZMVGCMLXSJ-UHFFFAOYSA-N |
| XLogP | 11.21 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.87 |
| LogP ≤ 5 | 11.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|