C21H29N — CID 67687231
4-[1-(4-ethylphenyl)heptyl]aniline (PubChem CID 67687231) has the molecular formula C21H29N and a molecular weight of 295.47 g/mol. Its IUPAC name is 4-[1-(4-ethylphenyl)heptyl]aniline.
| Compound Name | 4-[1-(4-ethylphenyl)heptyl]aniline |
|---|---|
| PubChem CID | 67687231 |
| Molecular Formula | C21H29N |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | 4-[1-(4-ethylphenyl)heptyl]aniline |
| SMILES | CCCCCCC(c1ccc(N)cc1)c1ccc(CC)cc1 |
| InChI | InChI=1S/C21H29N/c1-3-5-6-7-8-21(19-13-15-20(22)16-14-19)18-11-9-17(4-2)10-12-18/h9-16,21H,3-8,22H2,1-2H3 |
| InChIKey | CPMSELVWISJUBM-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|