C37H46N2 — CID 22919318
4-[1-[4-[1-[4-[1-(4-aminophenyl)pentyl]phenyl]propyl]phenyl]pentyl]aniline (PubChem CID 22919318) has the molecular formula C37H46N2 and a molecular weight of 518.79 g/mol. Its IUPAC name is 4-[1-[4-[1-[4-[1-(4-aminophenyl)pentyl]phenyl]propyl]phenyl]pentyl]aniline.
| Compound Name | 4-[1-[4-[1-[4-[1-(4-aminophenyl)pentyl]phenyl]propyl]phenyl]pentyl]aniline |
|---|---|
| PubChem CID | 22919318 |
| Molecular Formula | C37H46N2 |
| Molecular Weight | 518.79 g/mol |
| Exact Mass | 518.37 |
| IUPAC Name | 4-[1-[4-[1-[4-[1-(4-aminophenyl)pentyl]phenyl]propyl]phenyl]pentyl]aniline |
| SMILES | CCCCC(c1ccc(N)cc1)c1ccc(C(CC)c2ccc(C(CCCC)c3ccc(N)cc3)cc2)cc1 |
| InChI | InChI=1S/C37H46N2/c1-4-7-9-36(31-19-23-33(38)24-20-31)29-15-11-27(12-16-29)35(6-3)28-13-17-30(18-14-28)37(10-8-5-2)32-21-25-34(39)26-22-32/h11-26,35-37H,4-10,38-39H2,1-3H3 |
| InChIKey | OIXJGGDKKJVLDL-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.79 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|