C38H48N2 — CID 18976753
4-[1-[4-[2-[4-[1-(4-aminophenyl)pentyl]phenyl]butyl]phenyl]pentyl]aniline (PubChem CID 18976753) has the molecular formula C38H48N2 and a molecular weight of 532.82 g/mol. Its IUPAC name is 4-[1-[4-[2-[4-[1-(4-aminophenyl)pentyl]phenyl]butyl]phenyl]pentyl]aniline.
| Compound Name | 4-[1-[4-[2-[4-[1-(4-aminophenyl)pentyl]phenyl]butyl]phenyl]pentyl]aniline |
|---|---|
| PubChem CID | 18976753 |
| Molecular Formula | C38H48N2 |
| Molecular Weight | 532.82 g/mol |
| Exact Mass | 532.38 |
| IUPAC Name | 4-[1-[4-[2-[4-[1-(4-aminophenyl)pentyl]phenyl]butyl]phenyl]pentyl]aniline |
| SMILES | CCCCC(c1ccc(N)cc1)c1ccc(CC(CC)c2ccc(C(CCCC)c3ccc(N)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H48N2/c1-4-7-9-37(33-19-23-35(39)24-20-33)31-13-11-28(12-14-31)27-29(6-3)30-15-17-32(18-16-30)38(10-8-5-2)34-21-25-36(40)26-22-34/h11-26,29,37-38H,4-10,27,39-40H2,1-3H3 |
| InChIKey | INYYSCFOSPRKKF-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.82 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|