About 7,7-bis(4-hydroxyphenyl)heptane-1,4-diol
7,7-bis(4-hydroxyphenyl)heptane-1,4-diol (PubChem CID 70141145) has the molecular formula C19H24O4
and a molecular weight of 316.40 g/mol. Its IUPAC name is 7,7-bis(4-hydroxyphenyl)heptane-1,4-diol.
Molecular Properties
| Compound Name | 7,7-bis(4-hydroxyphenyl)heptane-1,4-diol |
| PubChem CID | 70141145 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 7,7-bis(4-hydroxyphenyl)heptane-1,4-diol |
| SMILES | OCCCC(O)CCC(c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C19H24O4/c20-13-1-2-16(21)11-12-19(14-3-7-17(22)8-4-14)15-5-9-18(23)10-6-15/h3-10,16,19-23H,1-2,11-13H2 |
| InChIKey | CDQBHZWRPHZPQI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7,7-bis(4-hydroxyphenyl)heptane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7-bis(4-hydroxyphenyl)heptane-1,4-diol?
The IUPAC name of 7,7-bis(4-hydroxyphenyl)heptane-1,4-diol (CID 70141145) is 7,7-bis(4-hydroxyphenyl)heptane-1,4-diol.
What is the SMILES notation for 7,7-bis(4-hydroxyphenyl)heptane-1,4-diol?
The canonical SMILES for 7,7-bis(4-hydroxyphenyl)heptane-1,4-diol is OCCCC(O)CCC(c1ccc(O)cc1)c1ccc(O)cc1.
What is the InChIKey of 7,7-bis(4-hydroxyphenyl)heptane-1,4-diol?
The InChIKey is CDQBHZWRPHZPQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24O4/c20-13-1-2-16(21)11-12-19(14-3-7-17(22)8-4-14)15-5-9-18(23)10-6-15/h3-10,16,19-23H,1-2,11-13H2.
What are the key properties of 7,7-bis(4-hydroxyphenyl)heptane-1,4-diol?
7,7-bis(4-hydroxyphenyl)heptane-1,4-diol has a molecular weight of 316.40 g/mol, XLogP of 3.14, 8 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7-bis(4-hydroxyphenyl)heptane-1,4-diol is sourced from PubChem (CID 70141145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).