C19H24O4 — CID 70141145
7,7-bis(4-hydroxyphenyl)heptane-1,4-diol (PubChem CID 70141145) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is 7,7-bis(4-hydroxyphenyl)heptane-1,4-diol.
| Compound Name | 7,7-bis(4-hydroxyphenyl)heptane-1,4-diol |
|---|---|
| PubChem CID | 70141145 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 7,7-bis(4-hydroxyphenyl)heptane-1,4-diol |
| SMILES | OCCCC(O)CCC(c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C19H24O4/c20-13-1-2-16(21)11-12-19(14-3-7-17(22)8-4-14)15-5-9-18(23)10-6-15/h3-10,16,19-23H,1-2,11-13H2 |
| InChIKey | CDQBHZWRPHZPQI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |