C18H22O — CID 57258566
6,6-diphenylhexan-3-ol (PubChem CID 57258566) has the molecular formula C18H22O and a molecular weight of 254.37 g/mol. Its IUPAC name is 6,6-diphenylhexan-3-ol.
| Compound Name | 6,6-diphenylhexan-3-ol |
|---|---|
| PubChem CID | 57258566 |
| Molecular Formula | C18H22O |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 6,6-diphenylhexan-3-ol |
| SMILES | CCC(O)CCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H22O/c1-2-17(19)13-14-18(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,17-19H,2,13-14H2,1H3 |
| InChIKey | QTAIJSWDVFNUJW-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |