C14H30O4 — CID 57081340
tetradecane-3,6,9,12-tetrol (PubChem CID 57081340) has the molecular formula C14H30O4 and a molecular weight of 262.39 g/mol. Its IUPAC name is tetradecane-3,6,9,12-tetrol.
| Compound Name | tetradecane-3,6,9,12-tetrol |
|---|---|
| PubChem CID | 57081340 |
| Molecular Formula | C14H30O4 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.21 |
| IUPAC Name | tetradecane-3,6,9,12-tetrol |
| SMILES | CCC(O)CCC(O)CCC(O)CCC(O)CC |
| InChI | InChI=1S/C14H30O4/c1-3-11(15)5-7-13(17)9-10-14(18)8-6-12(16)4-2/h11-18H,3-10H2,1-2H3 |
| InChIKey | DITVSLRDOHXSLB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |