C12H26O4 — CID 59068921
(3S,5R,8R,10S)-dodecane-3,5,8,10-tetrol (PubChem CID 59068921) has the molecular formula C12H26O4 and a molecular weight of 234.34 g/mol. Its IUPAC name is (3S,5R,8R,10S)-dodecane-3,5,8,10-tetrol.
| Compound Name | (3S,5R,8R,10S)-dodecane-3,5,8,10-tetrol |
|---|---|
| PubChem CID | 59068921 |
| Molecular Formula | C12H26O4 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | (3S,5R,8R,10S)-dodecane-3,5,8,10-tetrol |
| SMILES | CC[C@H](O)C[C@H](O)CC[C@@H](O)C[C@@H](O)CC |
| InChI | InChI=1S/C12H26O4/c1-3-9(13)7-11(15)5-6-12(16)8-10(14)4-2/h9-16H,3-8H2,1-2H3/t9-,10-,11+,12+/m0/s1 |
| InChIKey | ZNMIPAIDKXXPBP-NNYUYHANSA-N |
| XLogP | 0.81 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |