C12H28N2O2 — CID 165390918
3,10-diaminododecane-5,8-diol (PubChem CID 165390918) has the molecular formula C12H28N2O2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 3,10-diaminododecane-5,8-diol.
| Compound Name | 3,10-diaminododecane-5,8-diol |
|---|---|
| PubChem CID | 165390918 |
| Molecular Formula | C12H28N2O2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | 3,10-diaminododecane-5,8-diol |
| SMILES | CCC(N)CC(O)CCC(O)CC(N)CC |
| InChI | InChI=1S/C12H28N2O2/c1-3-9(13)7-11(15)5-6-12(16)8-10(14)4-2/h9-12,15-16H,3-8,13-14H2,1-2H3 |
| InChIKey | MVCLQDKDGHCATD-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |