About 2-aminooctadecane-1,4-diol
2-aminooctadecane-1,4-diol (PubChem CID 12701355) has the molecular formula C18H39NO2
and a molecular weight of 301.52 g/mol. Its IUPAC name is 2-aminooctadecane-1,4-diol.
Molecular Properties
| Compound Name | 2-aminooctadecane-1,4-diol |
| PubChem CID | 12701355 |
| Molecular Formula | C18H39NO2 |
| Molecular Weight | 301.52 g/mol |
| Exact Mass | 301.30 |
| IUPAC Name | 2-aminooctadecane-1,4-diol |
| SMILES | CCCCCCCCCCCCCCC(O)CC(N)CO |
| InChI | InChI=1S/C18H39NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-18(21)15-17(19)16-20/h17-18,20-21H,2-16,19H2,1H3 |
| InChIKey | OZGVEPKWZPMSAC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-aminooctadecane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminooctadecane-1,4-diol?
The IUPAC name of 2-aminooctadecane-1,4-diol (CID 12701355) is 2-aminooctadecane-1,4-diol.
What is the SMILES notation for 2-aminooctadecane-1,4-diol?
The canonical SMILES for 2-aminooctadecane-1,4-diol is CCCCCCCCCCCCCCC(O)CC(N)CO.
What is the InChIKey of 2-aminooctadecane-1,4-diol?
The InChIKey is OZGVEPKWZPMSAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H39NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-18(21)15-17(19)16-20/h17-18,20-21H,2-16,19H2,1H3.
What are the key properties of 2-aminooctadecane-1,4-diol?
2-aminooctadecane-1,4-diol has a molecular weight of 301.52 g/mol, XLogP of 4.15, 16 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminooctadecane-1,4-diol is sourced from PubChem (CID 12701355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).