C18H39NO2 — CID 12701356
(2R,4R)-2-aminooctadecane-1,4-diol (PubChem CID 12701356) has the molecular formula C18H39NO2 and a molecular weight of 301.52 g/mol. Its IUPAC name is (2R,4R)-2-aminooctadecane-1,4-diol.
| Compound Name | (2R,4R)-2-aminooctadecane-1,4-diol |
|---|---|
| PubChem CID | 12701356 |
| Molecular Formula | C18H39NO2 |
| Molecular Weight | 301.52 g/mol |
| Exact Mass | 301.30 |
| IUPAC Name | (2R,4R)-2-aminooctadecane-1,4-diol |
| SMILES | CCCCCCCCCCCCCC[C@@H](O)C[C@@H](N)CO |
| InChI | InChI=1S/C18H39NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-18(21)15-17(19)16-20/h17-18,20-21H,2-16,19H2,1H3/t17-,18-/m1/s1 |
| InChIKey | OZGVEPKWZPMSAC-QZTJIDSGSA-N |
| XLogP | 4.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|